C15H24N2 — CID 71815920
3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methyl-1H-pyrazole (PubChem CID 71815920) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methyl-1H-pyrazole.
| Compound Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 71815920 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-methyl-1H-pyrazole |
| SMILES | CC(C)=CCC/C(C)=C/CCc1cc(C)[nH]n1 |
| InChI | InChI=1S/C15H24N2/c1-12(2)7-5-8-13(3)9-6-10-15-11-14(4)16-17-15/h7,9,11H,5-6,8,10H2,1-4H3,(H,16,17)/b13-9+ |
| InChIKey | QNQRXTUHNMJPLG-UKTHLTGXSA-N |
| XLogP | 4.34 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|