C10H16N2 — CID 71816169
(2S,3R)-2,3-diethyl-2,3-dimethylbutanedinitrile (PubChem CID 71816169) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (2S,3R)-2,3-diethyl-2,3-dimethylbutanedinitrile.
| Compound Name | (2S,3R)-2,3-diethyl-2,3-dimethylbutanedinitrile |
|---|---|
| PubChem CID | 71816169 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2S,3R)-2,3-diethyl-2,3-dimethylbutanedinitrile |
| SMILES | CC[C@](C)(C#N)[C@](C)(C#N)CC |
| InChI | InChI=1S/C10H16N2/c1-5-9(3,7-11)10(4,6-2)8-12/h5-6H2,1-4H3/t9-,10+ |
| InChIKey | YPKRPUBUHLHYRJ-AOOOYVTPSA-N |
| XLogP | 2.87 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |