C25H27N5O3 — CID 71816334
4-methyl-6-[(E)-5-(6-piperidin-1-ylpurin-9-yl)pent-2-enoxy]chromen-2-one (PubChem CID 71816334) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-methyl-6-[(E)-5-(6-piperidin-1-ylpurin-9-yl)pent-2-enoxy]chromen-2-one.
| Compound Name | 4-methyl-6-[(E)-5-(6-piperidin-1-ylpurin-9-yl)pent-2-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 71816334 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-methyl-6-[(E)-5-(6-piperidin-1-ylpurin-9-yl)pent-2-enoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2ccc(OC/C=C/CCn3cnc4c(N5CCCCC5)ncnc43)cc12 |
| InChI | InChI=1S/C25H27N5O3/c1-18-14-22(31)33-21-9-8-19(15-20(18)21)32-13-7-3-6-12-30-17-28-23-24(26-16-27-25(23)30)29-10-4-2-5-11-29/h3,7-9,14-17H,2,4-6,10-13H2,1H3/b7-3+ |
| InChIKey | LIFICNZLRORTHU-XVNBXDOJSA-N |
| XLogP | 4.26 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|