About 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole
3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole (PubChem CID 71816441) has the molecular formula C20H14Cl2N2O
and a molecular weight of 369.25 g/mol. Its IUPAC name is 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole |
| PubChem CID | 71816441 |
| Molecular Formula | C20H14Cl2N2O |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole |
| SMILES | Clc1ccc(C2=NOC(c3ccc(Cl)cc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14Cl2N2O/c21-16-10-6-14(7-11-16)19-23-25-20(15-8-12-17(22)13-9-15)24(19)18-4-2-1-3-5-18/h1-13,20H |
| InChIKey | ITEYZGVPFOPHIE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole?
The IUPAC name of 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole (CID 71816441) is 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole.
What is the SMILES notation for 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole?
The canonical SMILES for 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole is Clc1ccc(C2=NOC(c3ccc(Cl)cc3)N2c2ccccc2)cc1.
What is the InChIKey of 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole?
The InChIKey is ITEYZGVPFOPHIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2N2O/c21-16-10-6-14(7-11-16)19-23-25-20(15-8-12-17(22)13-9-15)24(19)18-4-2-1-3-5-18/h1-13,20H.
What are the key properties of 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole?
3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole has a molecular weight of 369.25 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4-chlorophenyl)-4-phenyl-5H-1,2,4-oxadiazole is sourced from PubChem (CID 71816441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).