C22H20N4O3 — CID 71816666
4-[8-(3,4-dimethoxyphenyl)-4,5-dihydropyrazolo[3,4-g][1,2]benzoxazol-7-yl]aniline (PubChem CID 71816666) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[8-(3,4-dimethoxyphenyl)-4,5-dihydropyrazolo[3,4-g][1,2]benzoxazol-7-yl]aniline.
| Compound Name | 4-[8-(3,4-dimethoxyphenyl)-4,5-dihydropyrazolo[3,4-g][1,2]benzoxazol-7-yl]aniline |
|---|---|
| PubChem CID | 71816666 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[8-(3,4-dimethoxyphenyl)-4,5-dihydropyrazolo[3,4-g][1,2]benzoxazol-7-yl]aniline |
| SMILES | COc1ccc(-c2c3c(nn2-c2ccc(N)cc2)CCc2cnoc2-3)cc1OC |
| InChI | InChI=1S/C22H20N4O3/c1-27-18-10-4-13(11-19(18)28-2)21-20-17(9-3-14-12-24-29-22(14)20)25-26(21)16-7-5-15(23)6-8-16/h4-8,10-12H,3,9,23H2,1-2H3 |
| InChIKey | VFCDYITYEXFMDF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|