C32H31FO4 — CID 71816761
(1S,1aS,6aR)-3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (PubChem CID 71816761) has the molecular formula C32H31FO4 and a molecular weight of 498.59 g/mol. Its IUPAC name is (1S,1aS,6aR)-3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid.
| Compound Name | (1S,1aS,6aR)-3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
|---|---|
| PubChem CID | 71816761 |
| Molecular Formula | C32H31FO4 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (1S,1aS,6aR)-3-[[3-(5,5-dimethylcyclopenten-1-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| SMILES | COc1ccc(F)c(-c2ccc(COc3ccc4c(c3)[C@H]3[C@@H](C4)[C@@H]3C(=O)O)cc2C2=CCCC2(C)C)c1 |
| InChI | InChI=1S/C32H31FO4/c1-32(2)12-4-5-27(32)24-13-18(6-10-22(24)25-15-20(36-3)9-11-28(25)33)17-37-21-8-7-19-14-26-29(23(19)16-21)30(26)31(34)35/h5-11,13,15-16,26,29-30H,4,12,14,17H2,1-3H3,(H,34,35)/t26-,29+,30+/m1/s1 |
| InChIKey | YTEOUTFTINDAON-POLDFPFKSA-N |
| XLogP | 7.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |