C29H48O4Si — CID 71817069
[(2R,3S)-3-[[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methyl]-3-(phenylmethoxymethyl)oxiran-2-yl]methanol (PubChem CID 71817069) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is [(2R,3S)-3-[[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methyl]-3-(phenylmethoxymethyl)oxiran-2-yl]methanol.
| Compound Name | [(2R,3S)-3-[[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methyl]-3-(phenylmethoxymethyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 71817069 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | [(2R,3S)-3-[[(4R,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-4-propan-2-ylcyclopenten-1-yl]methyl]-3-(phenylmethoxymethyl)oxiran-2-yl]methanol |
| SMILES | CC(C)[C@H]1CC=C(C[C@@]2(COCc3ccccc3)O[C@@H]2CO)[C@]1(C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H48O4Si/c1-22(2)25-15-14-24(28(25,6)16-17-32-34(7,8)27(3,4)5)18-29(26(19-30)33-29)21-31-20-23-12-10-9-11-13-23/h9-14,22,25-26,30H,15-21H2,1-8H3/t25-,26-,28+,29+/m1/s1 |
| InChIKey | YTMJESJEJQAJNH-KFADFNFCSA-N |
| XLogP | 6.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|