C30H31NO5 — CID 71817075
tert-butyl (2S,3R)-3-hydroxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate (PubChem CID 71817075) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-hydroxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-3-hydroxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 71817075 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | tert-butyl (2S,3R)-3-hydroxy-6-oxo-2-(trityloxymethyl)-2,3-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C=C[C@@H](O)[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO5/c1-29(2,3)36-28(34)31-25(26(32)19-20-27(31)33)21-35-30(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-20,25-26,32H,21H2,1-3H3/t25-,26+/m0/s1 |
| InChIKey | AKMYDTFTEQNWBZ-IZZNHLLZSA-N |
| XLogP | 5.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|