About (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone
(5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone (PubChem CID 71817336) has the molecular formula C20H15Cl2N3O
and a molecular weight of 384.27 g/mol. Its IUPAC name is (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone.
Molecular Properties
| Compound Name | (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone |
| PubChem CID | 71817336 |
| Molecular Formula | C20H15Cl2N3O |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone |
| SMILES | O=C(c1cc2cc(Cl)ccc2[nH]1)N1CC(CCl)c2c1ccc1[nH]ccc21 |
| InChI | InChI=1S/C20H15Cl2N3O/c21-9-12-10-25(18-4-3-16-14(19(12)18)5-6-23-16)20(26)17-8-11-7-13(22)1-2-15(11)24-17/h1-8,12,23-24H,9-10H2 |
| InChIKey | VZPWDHJYPPDQTA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone?
The IUPAC name of (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone (CID 71817336) is (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone.
What is the SMILES notation for (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone?
The canonical SMILES for (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone is O=C(c1cc2cc(Cl)ccc2[nH]1)N1CC(CCl)c2c1ccc1[nH]ccc21.
What is the InChIKey of (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone?
The InChIKey is VZPWDHJYPPDQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N3O/c21-9-12-10-25(18-4-3-16-14(19(12)18)5-6-23-16)20(26)17-8-11-7-13(22)1-2-15(11)24-17/h1-8,12,23-24H,9-10H2.
What are the key properties of (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone?
(5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone has a molecular weight of 384.27 g/mol, XLogP of 5.29, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1H-indol-2-yl)-[8-(chloromethyl)-7,8-dihydro-3H-pyrrolo[3,2-e]indol-6-yl]methanone is sourced from PubChem (CID 71817336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).