About 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine
1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine (PubChem CID 71817366) has the molecular formula C27H30N2O
and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine.
Molecular Properties
| Compound Name | 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine |
| PubChem CID | 71817366 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine |
| SMILES | C/C(=C(\c1ccccc1)c1ccc(OCCN2CCNCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O/c1-22(23-8-4-2-5-9-23)27(24-10-6-3-7-11-24)25-12-14-26(15-13-25)30-21-20-29-18-16-28-17-19-29/h2-15,28H,16-21H2,1H3/b27-22- |
| InChIKey | FHCKXXXJXYWFJW-QYQHSDTDSA-N |
| XLogP | 4.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine?
The IUPAC name of 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine (CID 71817366) is 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine.
What is the SMILES notation for 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine?
The canonical SMILES for 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine is C/C(=C(\c1ccccc1)c1ccc(OCCN2CCNCC2)cc1)c1ccccc1.
What is the InChIKey of 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine?
The InChIKey is FHCKXXXJXYWFJW-QYQHSDTDSA-N. The full InChI is InChI=1S/C27H30N2O/c1-22(23-8-4-2-5-9-23)27(24-10-6-3-7-11-24)25-12-14-26(15-13-25)30-21-20-29-18-16-28-17-19-29/h2-15,28H,16-21H2,1H3/b27-22-.
What are the key properties of 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine?
1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine has a molecular weight of 398.55 g/mol, XLogP of 4.95, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[4-[(Z)-1,2-diphenylprop-1-enyl]phenoxy]ethyl]piperazine is sourced from PubChem (CID 71817366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).