C30H31NO4 — CID 71817403
tert-butyl (2R)-6-oxo-2-(trityloxymethyl)-2,5-dihydropyridine-1-carboxylate (PubChem CID 71817403) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is tert-butyl (2R)-6-oxo-2-(trityloxymethyl)-2,5-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl (2R)-6-oxo-2-(trityloxymethyl)-2,5-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 71817403 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | tert-butyl (2R)-6-oxo-2-(trityloxymethyl)-2,5-dihydropyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC=C[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO4/c1-29(2,3)35-28(33)31-26(20-13-21-27(31)32)22-34-30(23-14-7-4-8-15-23,24-16-9-5-10-17-24)25-18-11-6-12-19-25/h4-20,26H,21-22H2,1-3H3/t26-/m1/s1 |
| InChIKey | WMAVTFMJMYATSX-AREMUKBSSA-N |
| XLogP | 6.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|