About (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one
(2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one (PubChem CID 71817404) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one |
| PubChem CID | 71817404 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one |
| SMILES | COc1ccc(CN2C(=O)C=C[C@@H](O)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-23-16-9-7-14(8-10-16)13-20-18(22)12-11-17(21)19(20)15-5-3-2-4-6-15/h2-12,17,19,21H,13H2,1H3/t17-,19+/m1/s1 |
| InChIKey | JIAHAKCDTVAJIW-MJGOQNOKSA-N |
| XLogP | 2.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one?
The IUPAC name of (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one (CID 71817404) is (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one.
What is the SMILES notation for (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one?
The canonical SMILES for (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one is COc1ccc(CN2C(=O)C=C[C@@H](O)[C@@H]2c2ccccc2)cc1.
What is the InChIKey of (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one?
The InChIKey is JIAHAKCDTVAJIW-MJGOQNOKSA-N. The full InChI is InChI=1S/C19H19NO3/c1-23-16-9-7-14(8-10-16)13-20-18(22)12-11-17(21)19(20)15-5-3-2-4-6-15/h2-12,17,19,21H,13H2,1H3/t17-,19+/m1/s1.
What are the key properties of (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one?
(2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one has a molecular weight of 309.37 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 71817404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).