C27H27NO4 — CID 71817518
(R)-[(3R,5S,6S)-5-[(E)-3-(4-nitrophenyl)prop-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol (PubChem CID 71817518) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (R)-[(3R,5S,6S)-5-[(E)-3-(4-nitrophenyl)prop-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol.
| Compound Name | (R)-[(3R,5S,6S)-5-[(E)-3-(4-nitrophenyl)prop-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol |
|---|---|
| PubChem CID | 71817518 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (R)-[(3R,5S,6S)-5-[(E)-3-(4-nitrophenyl)prop-2-enyl]-6-phenyloxan-3-yl]-phenylmethanol |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C[C@H]2C[C@@H]([C@@H](O)c3ccccc3)CO[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NO4/c29-26(21-9-3-1-4-10-21)24-18-23(27(32-19-24)22-11-5-2-6-12-22)13-7-8-20-14-16-25(17-15-20)28(30)31/h1-12,14-17,23-24,26-27,29H,13,18-19H2/b8-7+/t23-,24+,26-,27+/m0/s1 |
| InChIKey | JHZGZVZICSVZBN-FNHDHFIBSA-N |
| XLogP | 6.13 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|