C16H13ClF3N3O2 — CID 71817779
9-(2-chloroethyl)-1,3-dimethyl-5-(trifluoromethyl)pyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 71817779) has the molecular formula C16H13ClF3N3O2 and a molecular weight of 371.75 g/mol. Its IUPAC name is 9-(2-chloroethyl)-1,3-dimethyl-5-(trifluoromethyl)pyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 9-(2-chloroethyl)-1,3-dimethyl-5-(trifluoromethyl)pyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 71817779 |
| Molecular Formula | C16H13ClF3N3O2 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 9-(2-chloroethyl)-1,3-dimethyl-5-(trifluoromethyl)pyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | Cn1c(=O)c2c(C(F)(F)F)c3cccc(CCCl)c3nc2n(C)c1=O |
| InChI | InChI=1S/C16H13ClF3N3O2/c1-22-13-10(14(24)23(2)15(22)25)11(16(18,19)20)9-5-3-4-8(6-7-17)12(9)21-13/h3-5H,6-7H2,1-2H3 |
| InChIKey | SSNUGSGQPJNIDY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|