C24H33N7O4 — CID 71817811
methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 71817811) has the molecular formula C24H33N7O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 71817811 |
| Molecular Formula | C24H33N7O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | methyl (2S)-2-[[4-amino-3-[[(2S)-2-amino-4-phenylbutanoyl]amino]benzoyl]amino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NC(=O)c1ccc(N)c(NC(=O)[C@@H](N)CCc2ccccc2)c1 |
| InChI | InChI=1S/C24H33N7O4/c1-35-23(34)19(8-5-13-29-24(27)28)30-21(32)16-10-12-17(25)20(14-16)31-22(33)18(26)11-9-15-6-3-2-4-7-15/h2-4,6-7,10,12,14,18-19H,5,8-9,11,13,25-26H2,1H3,(H,30,32)(H,31,33)(H4,27,28,29)/t18-,19-/m0/s1 |
| InChIKey | YRFGDUGPCWFJRP-OALUTQOASA-N |
| XLogP | 0.49 |
| TPSA | 200.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|