About 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine
2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine (PubChem CID 71817955) has the molecular formula C23H32N8
and a molecular weight of 420.57 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine |
| PubChem CID | 71817955 |
| Molecular Formula | C23H32N8 |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine |
| SMILES | Nc1ccccc1CNc1nc(NC2CCC(N)CC2)nc2c1ncn2C1CCCC1 |
| InChI | InChI=1S/C23H32N8/c24-16-9-11-17(12-10-16)28-23-29-21(26-13-15-5-1-4-8-19(15)25)20-22(30-23)31(14-27-20)18-6-2-3-7-18/h1,4-5,8,14,16-18H,2-3,6-7,9-13,24-25H2,(H2,26,28,29,30) |
| InChIKey | AARWBLSNYKXRJZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 119.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine?
The IUPAC name of 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine (CID 71817955) is 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine.
What is the SMILES notation for 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine?
The canonical SMILES for 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine is Nc1ccccc1CNc1nc(NC2CCC(N)CC2)nc2c1ncn2C1CCCC1.
What is the InChIKey of 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine?
The InChIKey is AARWBLSNYKXRJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N8/c24-16-9-11-17(12-10-16)28-23-29-21(26-13-15-5-1-4-8-19(15)25)20-22(30-23)31(14-27-20)18-6-2-3-7-18/h1,4-5,8,14,16-18H,2-3,6-7,9-13,24-25H2,(H2,26,28,29,30).
What are the key properties of 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine?
2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine has a molecular weight of 420.57 g/mol, XLogP of 3.82, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-aminocyclohexyl)-6-N-[(2-aminophenyl)methyl]-9-cyclopentylpurine-2,6-diamine is sourced from PubChem (CID 71817955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).