About (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile
(3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile (PubChem CID 71818171) has the molecular formula C22H29NO2Si
and a molecular weight of 367.56 g/mol. Its IUPAC name is (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile.
Molecular Properties
| Compound Name | (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile |
| PubChem CID | 71818171 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile |
| SMILES | CC(C)[C@H](O[Si](C)(C)C)[C@@H](O)C(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO2Si/c1-17(2)20(25-26(3,4)5)21(24)22(16-23,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20-21,24H,1-5H3/t20-,21+/m0/s1 |
| InChIKey | OTWOKWJSAOBTNS-LEWJYISDSA-N |
| XLogP | 4.73 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile?
The IUPAC name of (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile (CID 71818171) is (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile.
What is the SMILES notation for (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile?
The canonical SMILES for (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile is CC(C)[C@H](O[Si](C)(C)C)[C@@H](O)C(C#N)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile?
The InChIKey is OTWOKWJSAOBTNS-LEWJYISDSA-N. The full InChI is InChI=1S/C22H29NO2Si/c1-17(2)20(25-26(3,4)5)21(24)22(16-23,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20-21,24H,1-5H3/t20-,21+/m0/s1.
What are the key properties of (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile?
(3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile has a molecular weight of 367.56 g/mol, XLogP of 4.73, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-hydroxy-5-methyl-2,2-diphenyl-4-trimethylsilyloxyhexanenitrile is sourced from PubChem (CID 71818171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).