C21H16N2O3S2 — CID 71818301
N-[[4-(benzenesulfonyl)phenyl]methyl]thieno[3,2-b]pyridine-2-carboxamide (PubChem CID 71818301) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[[4-(benzenesulfonyl)phenyl]methyl]thieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | N-[[4-(benzenesulfonyl)phenyl]methyl]thieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71818301 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-[[4-(benzenesulfonyl)phenyl]methyl]thieno[3,2-b]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)c2ccccc2)cc1)c1cc2ncccc2s1 |
| InChI | InChI=1S/C21H16N2O3S2/c24-21(20-13-18-19(27-20)7-4-12-22-18)23-14-15-8-10-17(11-9-15)28(25,26)16-5-2-1-3-6-16/h1-13H,14H2,(H,23,24) |
| InChIKey | HLBSBCNHYMLASJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |