About [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid
[1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid (PubChem CID 71818399) has the molecular formula C21H20Cl2NO5PS
and a molecular weight of 500.34 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid.
Molecular Properties
| Compound Name | [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid |
| PubChem CID | 71818399 |
| Molecular Formula | C21H20Cl2NO5PS |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid |
| SMILES | O=C(c1ccccc1Cc1cccs1)N(O)CCC(c1ccc(Cl)c(Cl)c1)P(=O)(O)O |
| InChI | InChI=1S/C21H20Cl2NO5PS/c22-18-8-7-15(13-19(18)23)20(30(27,28)29)9-10-24(26)21(25)17-6-2-1-4-14(17)12-16-5-3-11-31-16/h1-8,11,13,20,26H,9-10,12H2,(H2,27,28,29) |
| InChIKey | RNHFOWGQTCFQEC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid?
The IUPAC name of [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid (CID 71818399) is [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid.
What is the SMILES notation for [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid?
The canonical SMILES for [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid is O=C(c1ccccc1Cc1cccs1)N(O)CCC(c1ccc(Cl)c(Cl)c1)P(=O)(O)O.
What is the InChIKey of [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid?
The InChIKey is RNHFOWGQTCFQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2NO5PS/c22-18-8-7-15(13-19(18)23)20(30(27,28)29)9-10-24(26)21(25)17-6-2-1-4-14(17)12-16-5-3-11-31-16/h1-8,11,13,20,26H,9-10,12H2,(H2,27,28,29).
What are the key properties of [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid?
[1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid has a molecular weight of 500.34 g/mol, XLogP of 5.79, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dichlorophenyl)-3-[hydroxy-[2-(thiophen-2-ylmethyl)benzoyl]amino]propyl]phosphonic acid is sourced from PubChem (CID 71818399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).