C15H13NO3S — CID 71818861
2,3-bis(4-hydroxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 71818861) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2,3-bis(4-hydroxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2,3-bis(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71818861 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2,3-bis(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(O)cc2)N1c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13NO3S/c17-12-5-1-10(2-6-12)15-16(14(19)9-20-15)11-3-7-13(18)8-4-11/h1-8,15,17-18H,9H2 |
| InChIKey | HTOXUNMQGLKPTQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |