About 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile
10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile (PubChem CID 71819004) has the molecular formula C19H12N4O3
and a molecular weight of 344.33 g/mol. Its IUPAC name is 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile.
Molecular Properties
| Compound Name | 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
| PubChem CID | 71819004 |
| Molecular Formula | C19H12N4O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
| SMILES | COc1cccc(-n2c3nc(=O)[nH]c(=O)c-3cc3ccc(C#N)cc32)c1 |
| InChI | InChI=1S/C19H12N4O3/c1-26-14-4-2-3-13(9-14)23-16-7-11(10-20)5-6-12(16)8-15-17(23)21-19(25)22-18(15)24/h2-9H,1H3,(H,22,24,25) |
| InChIKey | LSNADVQDLSNQPZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile?
The IUPAC name of 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile (CID 71819004) is 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile.
What is the SMILES notation for 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile?
The canonical SMILES for 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile is COc1cccc(-n2c3nc(=O)[nH]c(=O)c-3cc3ccc(C#N)cc32)c1.
What is the InChIKey of 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile?
The InChIKey is LSNADVQDLSNQPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N4O3/c1-26-14-4-2-3-13(9-14)23-16-7-11(10-20)5-6-12(16)8-15-17(23)21-19(25)22-18(15)24/h2-9H,1H3,(H,22,24,25).
What are the key properties of 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile?
10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile has a molecular weight of 344.33 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile is sourced from PubChem (CID 71819004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).