C19H13N5O4S — CID 71819143
N-[3-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide (PubChem CID 71819143) has the molecular formula C19H13N5O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is N-[3-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide.
| Compound Name | N-[3-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 71819143 |
| Molecular Formula | C19H13N5O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[3-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-n2c3nc(=O)[nH]c(=O)c-3cc3ccc(C#N)cc32)c1 |
| InChI | InChI=1S/C19H13N5O4S/c1-29(27,28)23-13-3-2-4-14(9-13)24-16-7-11(10-20)5-6-12(16)8-15-17(24)21-19(26)22-18(15)25/h2-9,23H,1H3,(H,22,25,26) |
| InChIKey | IOJIGEMYRWLEQO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|