C18H13ClN4O4S — CID 71819145
N-[3-(7-chloro-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide (PubChem CID 71819145) has the molecular formula C18H13ClN4O4S and a molecular weight of 416.85 g/mol. Its IUPAC name is N-[3-(7-chloro-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide.
| Compound Name | N-[3-(7-chloro-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 71819145 |
| Molecular Formula | C18H13ClN4O4S |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | N-[3-(7-chloro-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-n2c3nc(=O)[nH]c(=O)c-3cc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C18H13ClN4O4S/c1-28(26,27)22-12-3-2-4-13(9-12)23-15-6-5-11(19)7-10(15)8-14-16(23)20-18(25)21-17(14)24/h2-9,22H,1H3,(H,21,24,25) |
| InChIKey | FTLUHHGOIQDJRK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|