C27H53NO8Si2 — CID 71819332
tert-butyl (3aS,5S,6R,6aS)-3a,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate (PubChem CID 71819332) has the molecular formula C27H53NO8Si2 and a molecular weight of 575.89 g/mol. Its IUPAC name is tert-butyl (3aS,5S,6R,6aS)-3a,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aS,5S,6R,6aS)-3a,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 71819332 |
| Molecular Formula | C27H53NO8Si2 |
| Molecular Weight | 575.89 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | tert-butyl (3aS,5S,6R,6aS)-3a,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6-formyloxy-2,2-dimethyl-6,6a-dihydro-5H-[1,3]dioxolo[4,5-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC=O)[C@@H]2OC(C)(C)O[C@@]21CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H53NO8Si2/c1-23(2,3)35-22(30)28-19(16-32-37(12,13)24(4,5)6)20(31-18-29)21-27(28,36-26(10,11)34-21)17-33-38(14,15)25(7,8)9/h18-21H,16-17H2,1-15H3/t19-,20+,21-,27-/m0/s1 |
| InChIKey | HHGUCYJTVJUFRQ-WFQVPWNOSA-N |
| XLogP | 6.04 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.89 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|