C21H29NO — CID 71819350
3,6-ditert-butyl-2-[(4-methoxyphenyl)methyl]pyridine (PubChem CID 71819350) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 3,6-ditert-butyl-2-[(4-methoxyphenyl)methyl]pyridine.
| Compound Name | 3,6-ditert-butyl-2-[(4-methoxyphenyl)methyl]pyridine |
|---|---|
| PubChem CID | 71819350 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 3,6-ditert-butyl-2-[(4-methoxyphenyl)methyl]pyridine |
| SMILES | COc1ccc(Cc2nc(C(C)(C)C)ccc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29NO/c1-20(2,3)17-12-13-19(21(4,5)6)22-18(17)14-15-8-10-16(23-7)11-9-15/h8-13H,14H2,1-7H3 |
| InChIKey | CNODKOMPBMRKNB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |