About 3-bromoquinolin-5-amine
3-bromoquinolin-5-amine (PubChem CID 71819688) has the molecular formula C9H7BrN2
and a molecular weight of 223.07 g/mol. Its IUPAC name is 3-bromoquinolin-5-amine.
Molecular Properties
| Compound Name | 3-bromoquinolin-5-amine |
| PubChem CID | 71819688 |
| Molecular Formula | C9H7BrN2 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 3-bromoquinolin-5-amine |
| SMILES | Nc1cccc2ncc(Br)cc12 |
| InChI | InChI=1S/C9H7BrN2/c10-6-4-7-8(11)2-1-3-9(7)12-5-6/h1-5H,11H2 |
| InChIKey | SVPUHAUIBLBKOQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoquinolin-5-amine?
The IUPAC name of 3-bromoquinolin-5-amine (CID 71819688) is 3-bromoquinolin-5-amine.
What is the SMILES notation for 3-bromoquinolin-5-amine?
The canonical SMILES for 3-bromoquinolin-5-amine is Nc1cccc2ncc(Br)cc12.
What is the InChIKey of 3-bromoquinolin-5-amine?
The InChIKey is SVPUHAUIBLBKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2/c10-6-4-7-8(11)2-1-3-9(7)12-5-6/h1-5H,11H2.
What are the key properties of 3-bromoquinolin-5-amine?
3-bromoquinolin-5-amine has a molecular weight of 223.07 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoquinolin-5-amine is sourced from PubChem (CID 71819688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).