About N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide
N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide (PubChem CID 71819722) has the molecular formula C15H21Cl2N3O4S2
and a molecular weight of 442.39 g/mol. Its IUPAC name is N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide.
Molecular Properties
| Compound Name | N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide |
| PubChem CID | 71819722 |
| Molecular Formula | C15H21Cl2N3O4S2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide |
| SMILES | O=C(CNc1cc(Cl)c(Cl)cc1O)N1CCC(NS(=O)(=O)CCS)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O4S2/c16-11-7-13(14(21)8-12(11)17)18-9-15(22)20-3-1-10(2-4-20)19-26(23,24)6-5-25/h7-8,10,18-19,21,25H,1-6,9H2 |
| InChIKey | HFVFGVIQRZRSML-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide?
The IUPAC name of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide (CID 71819722) is N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide.
What is the SMILES notation for N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide?
The canonical SMILES for N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide is O=C(CNc1cc(Cl)c(Cl)cc1O)N1CCC(NS(=O)(=O)CCS)CC1.
What is the InChIKey of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide?
The InChIKey is HFVFGVIQRZRSML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2N3O4S2/c16-11-7-13(14(21)8-12(11)17)18-9-15(22)20-3-1-10(2-4-20)19-26(23,24)6-5-25/h7-8,10,18-19,21,25H,1-6,9H2.
What are the key properties of N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide?
N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide has a molecular weight of 442.39 g/mol, XLogP of 1.95, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(4,5-dichloro-2-hydroxyanilino)acetyl]piperidin-4-yl]-2-sulfanylethanesulfonamide is sourced from PubChem (CID 71819722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).