C20H20F3NO3 — CID 71823627
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 4-(trifluoromethyl)benzoate (PubChem CID 71823627) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 71823627 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 4-(trifluoromethyl)benzoate |
| SMILES | CC(CCc1ccccc1)NC(=O)COC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO3/c1-14(7-8-15-5-3-2-4-6-15)24-18(25)13-27-19(26)16-9-11-17(12-10-16)20(21,22)23/h2-6,9-12,14H,7-8,13H2,1H3,(H,24,25) |
| InChIKey | BDWZTLVNDGNXSU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |