C17H25N3O5S — CID 71823771
3-(4-methylpiperidin-1-yl)sulfonyl-1-(2-morpholin-4-yl-2-oxoethyl)pyridin-2-one (PubChem CID 71823771) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-yl)sulfonyl-1-(2-morpholin-4-yl-2-oxoethyl)pyridin-2-one.
| Compound Name | 3-(4-methylpiperidin-1-yl)sulfonyl-1-(2-morpholin-4-yl-2-oxoethyl)pyridin-2-one |
|---|---|
| PubChem CID | 71823771 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3-(4-methylpiperidin-1-yl)sulfonyl-1-(2-morpholin-4-yl-2-oxoethyl)pyridin-2-one |
| SMILES | CC1CCN(S(=O)(=O)c2cccn(CC(=O)N3CCOCC3)c2=O)CC1 |
| InChI | InChI=1S/C17H25N3O5S/c1-14-4-7-20(8-5-14)26(23,24)15-3-2-6-19(17(15)22)13-16(21)18-9-11-25-12-10-18/h2-3,6,14H,4-5,7-13H2,1H3 |
| InChIKey | ZSJNKECAEVRAPM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |