C22H25N3O — CID 71824394
5-(4-ethylphenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide (PubChem CID 71824394) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(4-ethylphenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71824394 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 5-(4-ethylphenyl)-N-(4-phenylbutan-2-yl)-1H-pyrazole-4-carboxamide |
| SMILES | CCc1ccc(-c2[nH]ncc2C(=O)NC(C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-3-17-11-13-19(14-12-17)21-20(15-23-25-21)22(26)24-16(2)9-10-18-7-5-4-6-8-18/h4-8,11-16H,3,9-10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | WXAPCWLJQMAMKQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |