About 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile
2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile (PubChem CID 71825365) has the molecular formula C11H6N4OS2
and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile |
| PubChem CID | 71825365 |
| Molecular Formula | C11H6N4OS2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile |
| SMILES | Cc1nnc(Sc2ccc(C=C(C#N)C#N)o2)s1 |
| InChI | InChI=1S/C11H6N4OS2/c1-7-14-15-11(17-7)18-10-3-2-9(16-10)4-8(5-12)6-13/h2-4H,1H3 |
| InChIKey | PGRCKECBVMSSCO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 86.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile?
The IUPAC name of 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile (CID 71825365) is 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile.
What is the SMILES notation for 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile?
The canonical SMILES for 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile is Cc1nnc(Sc2ccc(C=C(C#N)C#N)o2)s1.
What is the InChIKey of 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile?
The InChIKey is PGRCKECBVMSSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N4OS2/c1-7-14-15-11(17-7)18-10-3-2-9(16-10)4-8(5-12)6-13/h2-4H,1H3.
What are the key properties of 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile?
2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile has a molecular weight of 274.33 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]furan-2-yl]methylidene]propanedinitrile is sourced from PubChem (CID 71825365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).