C24H14F2O6 — CID 71825843
10-(2,4-difluorophenyl)-5-hydroxy-3-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71825843) has the molecular formula C24H14F2O6 and a molecular weight of 436.37 g/mol. Its IUPAC name is 10-(2,4-difluorophenyl)-5-hydroxy-3-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 10-(2,4-difluorophenyl)-5-hydroxy-3-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71825843 |
| Molecular Formula | C24H14F2O6 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 10-(2,4-difluorophenyl)-5-hydroxy-3-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2ccc(F)cc2F)c2c(cc(O)c3c(=O)c(-c4ccc(O)cc4)coc23)O1 |
| InChI | InChI=1S/C24H14F2O6/c25-12-3-6-14(17(26)7-12)15-8-20(29)32-19-9-18(28)22-23(30)16(10-31-24(22)21(15)19)11-1-4-13(27)5-2-11/h1-7,9-10,15,27-28H,8H2 |
| InChIKey | BLHOCPCSVSHPNF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|