C28H24N2O6 — CID 71826429
5-hydroxy-3-(4-hydroxyphenyl)-10-(2-piperidin-1-yl-3-pyridinyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71826429) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is 5-hydroxy-3-(4-hydroxyphenyl)-10-(2-piperidin-1-yl-3-pyridinyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-hydroxy-3-(4-hydroxyphenyl)-10-(2-piperidin-1-yl-3-pyridinyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71826429 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-10-(2-piperidin-1-yl-3-pyridinyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2cccnc2N2CCCCC2)c2c(cc(O)c3c(=O)c(-c4ccc(O)cc4)coc23)O1 |
| InChI | InChI=1S/C28H24N2O6/c31-17-8-6-16(7-9-17)20-15-35-27-24-19(13-23(33)36-22(24)14-21(32)25(27)26(20)34)18-5-4-10-29-28(18)30-11-2-1-3-12-30/h4-10,14-15,19,31-32H,1-3,11-13H2 |
| InChIKey | IJIXIINKRSNEGF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|