C27H22O6S — CID 71826901
5-methoxy-3-(4-methoxyphenyl)-10-(4-methylsulfanylphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71826901) has the molecular formula C27H22O6S and a molecular weight of 474.53 g/mol. Its IUPAC name is 5-methoxy-3-(4-methoxyphenyl)-10-(4-methylsulfanylphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-methoxy-3-(4-methoxyphenyl)-10-(4-methylsulfanylphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71826901 |
| Molecular Formula | C27H22O6S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 5-methoxy-3-(4-methoxyphenyl)-10-(4-methylsulfanylphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(OC)c3c2=O)OC(=O)CC4c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C27H22O6S/c1-30-17-8-4-16(5-9-17)20-14-32-27-24-19(15-6-10-18(34-3)11-7-15)12-23(28)33-22(24)13-21(31-2)25(27)26(20)29/h4-11,13-14,19H,12H2,1-3H3 |
| InChIKey | ORGDMCQNBFUXSI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|