C21H17N3O2 — CID 71827262
10-phenyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one (PubChem CID 71827262) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 10-phenyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one.
| Compound Name | 10-phenyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
|---|---|
| PubChem CID | 71827262 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 10-phenyl-14-propan-2-yl-8-oxa-13,14,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,3,6,9,11,15-hexaen-5-one |
| SMILES | CC(C)n1[nH]cc2c(-c3ccccc3)c3oc4cc(=O)ccc4c3nc21 |
| InChI | InChI=1S/C21H17N3O2/c1-12(2)24-21-16(11-22-24)18(13-6-4-3-5-7-13)20-19(23-21)15-9-8-14(25)10-17(15)26-20/h3-12,22H,1-2H3 |
| InChIKey | NSWKZOSZWHTBEJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |