C21H24ClN3O4S — CID 71829443
4-(6-chloro-4H-1,3-benzodioxin-8-yl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one (PubChem CID 71829443) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 4-(6-chloro-4H-1,3-benzodioxin-8-yl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one.
| Compound Name | 4-(6-chloro-4H-1,3-benzodioxin-8-yl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
|---|---|
| PubChem CID | 71829443 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-(6-chloro-4H-1,3-benzodioxin-8-yl)-1-(2,2-dimethyloxan-4-yl)-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
| SMILES | CC1=Nc2c(c(=O)[nH]n2C2CCOC(C)(C)C2)C(c2cc(Cl)cc3c2OCOC3)S1 |
| InChI | InChI=1S/C21H24ClN3O4S/c1-11-23-19-16(20(26)24-25(19)14-4-5-29-21(2,3)8-14)18(30-11)15-7-13(22)6-12-9-27-10-28-17(12)15/h6-7,14,18H,4-5,8-10H2,1-3H3,(H,24,26) |
| InChIKey | NZFNCZMJHHAUTC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |