C39H27N3O9 — CID 71829962
methyl 5-[3,5-bis(4-methoxycarbonyl-3-phenyl-1,2-oxazol-5-yl)phenyl]-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 71829962) has the molecular formula C39H27N3O9 and a molecular weight of 681.66 g/mol. Its IUPAC name is methyl 5-[3,5-bis(4-methoxycarbonyl-3-phenyl-1,2-oxazol-5-yl)phenyl]-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 5-[3,5-bis(4-methoxycarbonyl-3-phenyl-1,2-oxazol-5-yl)phenyl]-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 71829962 |
| Molecular Formula | C39H27N3O9 |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | methyl 5-[3,5-bis(4-methoxycarbonyl-3-phenyl-1,2-oxazol-5-yl)phenyl]-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)noc1-c1cc(-c2onc(-c3ccccc3)c2C(=O)OC)cc(-c2onc(-c3ccccc3)c2C(=O)OC)c1 |
| InChI | InChI=1S/C39H27N3O9/c1-46-37(43)28-31(22-13-7-4-8-14-22)40-49-34(28)25-19-26(35-29(38(44)47-2)32(41-50-35)23-15-9-5-10-16-23)21-27(20-25)36-30(39(45)48-3)33(42-51-36)24-17-11-6-12-18-24/h4-21H,1-3H3 |
| InChIKey | UNTJQFJLHDCWTJ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 156.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|