C23H26N4O3 — CID 71830080
N-[1-(3,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylquinazoline-6-carboxamide (PubChem CID 71830080) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylquinazoline-6-carboxamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 71830080 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-4-pyrrolidin-1-ylquinazoline-6-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2ccc3ncnc(N4CCCC4)c3c2)cc1OC |
| InChI | InChI=1S/C23H26N4O3/c1-15(16-7-9-20(29-2)21(13-16)30-3)26-23(28)17-6-8-19-18(12-17)22(25-14-24-19)27-10-4-5-11-27/h6-9,12-15H,4-5,10-11H2,1-3H3,(H,26,28) |
| InChIKey | QCVWFLOHYFEXNX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |