About N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide
N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide (PubChem CID 71830143) has the molecular formula C24H21FN2O3
and a molecular weight of 404.44 g/mol. Its IUPAC name is N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide |
| PubChem CID | 71830143 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide |
| SMILES | Cc1oc2ccn(Cc3cccc(F)c3)c(=O)c2c1C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H21FN2O3/c1-16-21(23(28)26(2)14-17-7-4-3-5-8-17)22-20(30-16)11-12-27(24(22)29)15-18-9-6-10-19(25)13-18/h3-13H,14-15H2,1-2H3 |
| InChIKey | DZUPBSDBDDSWQZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide?
The IUPAC name of N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide (CID 71830143) is N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide.
What is the SMILES notation for N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide?
The canonical SMILES for N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide is Cc1oc2ccn(Cc3cccc(F)c3)c(=O)c2c1C(=O)N(C)Cc1ccccc1.
What is the InChIKey of N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide?
The InChIKey is DZUPBSDBDDSWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21FN2O3/c1-16-21(23(28)26(2)14-17-7-4-3-5-8-17)22-20(30-16)11-12-27(24(22)29)15-18-9-6-10-19(25)13-18/h3-13H,14-15H2,1-2H3.
What are the key properties of N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide?
N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide has a molecular weight of 404.44 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-[(3-fluorophenyl)methyl]-N,2-dimethyl-4-oxofuro[3,2-c]pyridine-3-carboxamide is sourced from PubChem (CID 71830143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).