C16H26N4O2 — CID 71830187
2-(diethylamino)-N-(2-methoxyethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide (PubChem CID 71830187) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2-methoxyethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide.
| Compound Name | 2-(diethylamino)-N-(2-methoxyethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 71830187 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-(diethylamino)-N-(2-methoxyethyl)-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
| SMILES | CCN(CC)c1ncc2c(n1)CCC(C(=O)NCCOC)C2 |
| InChI | InChI=1S/C16H26N4O2/c1-4-20(5-2)16-18-11-13-10-12(6-7-14(13)19-16)15(21)17-8-9-22-3/h11-12H,4-10H2,1-3H3,(H,17,21) |
| InChIKey | ATAVPHROZYOGKZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|