About 4-bromo-5-fluoro-1,3-dimethylpyrazole
4-bromo-5-fluoro-1,3-dimethylpyrazole (PubChem CID 71833020) has the molecular formula C5H6BrFN2
and a molecular weight of 193.02 g/mol. Its IUPAC name is 4-bromo-5-fluoro-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-5-fluoro-1,3-dimethylpyrazole |
| PubChem CID | 71833020 |
| Molecular Formula | C5H6BrFN2 |
| Molecular Weight | 193.02 g/mol |
| Exact Mass | 191.97 |
| IUPAC Name | 4-bromo-5-fluoro-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(F)c1Br |
| InChI | InChI=1S/C5H6BrFN2/c1-3-4(6)5(7)9(2)8-3/h1-2H3 |
| InChIKey | FQVSCBJYJWWQNS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.02 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5-fluoro-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-fluoro-1,3-dimethylpyrazole?
The IUPAC name of 4-bromo-5-fluoro-1,3-dimethylpyrazole (CID 71833020) is 4-bromo-5-fluoro-1,3-dimethylpyrazole.
What is the SMILES notation for 4-bromo-5-fluoro-1,3-dimethylpyrazole?
The canonical SMILES for 4-bromo-5-fluoro-1,3-dimethylpyrazole is Cc1nn(C)c(F)c1Br.
What is the InChIKey of 4-bromo-5-fluoro-1,3-dimethylpyrazole?
The InChIKey is FQVSCBJYJWWQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrFN2/c1-3-4(6)5(7)9(2)8-3/h1-2H3.
What are the key properties of 4-bromo-5-fluoro-1,3-dimethylpyrazole?
4-bromo-5-fluoro-1,3-dimethylpyrazole has a molecular weight of 193.02 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-fluoro-1,3-dimethylpyrazole is sourced from PubChem (CID 71833020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).