C16H14F3N5OS — CID 7183336
(2S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7183336) has the molecular formula C16H14F3N5OS and a molecular weight of 381.38 g/mol. Its IUPAC name is (2S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7183336 |
| Molecular Formula | C16H14F3N5OS |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (2S)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1cc(C)n2nc(S[C@@H](C)C(=O)Nc3ccc(F)c(F)c3F)nc2n1 |
| InChI | InChI=1S/C16H14F3N5OS/c1-7-6-8(2)24-15(20-7)22-16(23-24)26-9(3)14(25)21-11-5-4-10(17)12(18)13(11)19/h4-6,9H,1-3H3,(H,21,25)/t9-/m0/s1 |
| InChIKey | GGGKFYYUPGNHAD-VIFPVBQESA-N |
| XLogP | 3.28 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|