C21H21N7O — CID 71834158
3,6-dimethyl-N-[1-(2-methylpyrazol-3-yl)ethylideneamino]-1-phenylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 71834158) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 3,6-dimethyl-N-[1-(2-methylpyrazol-3-yl)ethylideneamino]-1-phenylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 3,6-dimethyl-N-[1-(2-methylpyrazol-3-yl)ethylideneamino]-1-phenylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 71834158 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3,6-dimethyl-N-[1-(2-methylpyrazol-3-yl)ethylideneamino]-1-phenylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(C)nc2c1c(C)nn2-c1ccccc1)c1ccnn1C |
| InChI | InChI=1S/C21H21N7O/c1-13-12-17(21(29)25-24-14(2)18-10-11-22-27(18)4)19-15(3)26-28(20(19)23-13)16-8-6-5-7-9-16/h5-12H,1-4H3,(H,25,29) |
| InChIKey | NSMABNUOEFFBIL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|