About methyl 3-(1,4-dioxan-2-yl)butanoate
methyl 3-(1,4-dioxan-2-yl)butanoate (PubChem CID 71834960) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is methyl 3-(1,4-dioxan-2-yl)butanoate.
Molecular Properties
| Compound Name | methyl 3-(1,4-dioxan-2-yl)butanoate |
| PubChem CID | 71834960 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | methyl 3-(1,4-dioxan-2-yl)butanoate |
| SMILES | COC(=O)CC(C)C1COCCO1 |
| InChI | InChI=1S/C9H16O4/c1-7(5-9(10)11-2)8-6-12-3-4-13-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | LNQAPXISXUYLQM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(1,4-dioxan-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,4-dioxan-2-yl)butanoate?
The IUPAC name of methyl 3-(1,4-dioxan-2-yl)butanoate (CID 71834960) is methyl 3-(1,4-dioxan-2-yl)butanoate.
What is the SMILES notation for methyl 3-(1,4-dioxan-2-yl)butanoate?
The canonical SMILES for methyl 3-(1,4-dioxan-2-yl)butanoate is COC(=O)CC(C)C1COCCO1.
What is the InChIKey of methyl 3-(1,4-dioxan-2-yl)butanoate?
The InChIKey is LNQAPXISXUYLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-7(5-9(10)11-2)8-6-12-3-4-13-8/h7-8H,3-6H2,1-2H3.
What are the key properties of methyl 3-(1,4-dioxan-2-yl)butanoate?
methyl 3-(1,4-dioxan-2-yl)butanoate has a molecular weight of 188.22 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,4-dioxan-2-yl)butanoate is sourced from PubChem (CID 71834960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).