About 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione
3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione (PubChem CID 71835307) has the molecular formula C22H16FN3O2
and a molecular weight of 373.39 g/mol. Its IUPAC name is 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione.
Molecular Properties
| Compound Name | 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
| PubChem CID | 71835307 |
| Molecular Formula | C22H16FN3O2 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
| SMILES | Cc1cccc2c1NC(=O)C21Nc2ccccc2C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FN3O2/c1-13-5-4-7-17-19(13)24-21(28)22(17)25-18-8-3-2-6-16(18)20(27)26(22)15-11-9-14(23)10-12-15/h2-12,25H,1H3,(H,24,28) |
| InChIKey | WRKIUKZLCCOWIE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
The IUPAC name of 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione (CID 71835307) is 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione.
What is the SMILES notation for 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
The canonical SMILES for 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione is Cc1cccc2c1NC(=O)C21Nc2ccccc2C(=O)N1c1ccc(F)cc1.
What is the InChIKey of 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
The InChIKey is WRKIUKZLCCOWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FN3O2/c1-13-5-4-7-17-19(13)24-21(28)22(17)25-18-8-3-2-6-16(18)20(27)26(22)15-11-9-14(23)10-12-15/h2-12,25H,1H3,(H,24,28).
What are the key properties of 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione has a molecular weight of 373.39 g/mol, XLogP of 4.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(4-fluorophenyl)-7-methylspiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione is sourced from PubChem (CID 71835307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).