C11H9N5S4 — CID 71835590
3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enethioamide (PubChem CID 71835590) has the molecular formula C11H9N5S4 and a molecular weight of 339.50 g/mol. Its IUPAC name is 3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enethioamide.
| Compound Name | 3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enethioamide |
|---|---|
| PubChem CID | 71835590 |
| Molecular Formula | C11H9N5S4 |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 3-[4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]thiophen-2-yl]-2-cyanoprop-2-enethioamide |
| SMILES | N#CC(=Cc1cc(CSc2nnc(N)s2)cs1)C(N)=S |
| InChI | InChI=1S/C11H9N5S4/c12-3-7(9(13)17)2-8-1-6(4-18-8)5-19-11-16-15-10(14)20-11/h1-2,4H,5H2,(H2,13,17)(H2,14,15) |
| InChIKey | CJDBTPKUUDOCNK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|