C12H17N3O7 — CID 7183581
(2S,3R,4R,5S,6S)-2-(3-amino-4-nitroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 7183581) has the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-(3-amino-4-nitroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-(3-amino-4-nitroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 7183581 |
| Molecular Formula | C12H17N3O7 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-(3-amino-4-nitroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1cc(N[C@H]2O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O7/c13-6-3-5(1-2-7(6)15(20)21)14-12-11(19)10(18)9(17)8(4-16)22-12/h1-3,8-12,14,16-19H,4,13H2/t8-,9+,10+,11+,12-/m0/s1 |
| InChIKey | PIJZZYSBXADVEM-KQSJRHEJSA-N |
| XLogP | -1.61 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|