About 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone
1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone (PubChem CID 71836281) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone.
Molecular Properties
| Compound Name | 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone |
| PubChem CID | 71836281 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(Nc2ncnc3c2CCC3)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-21-9-14(20)19-7-5-11(6-8-19)18-15-12-3-2-4-13(12)16-10-17-15/h10-11H,2-9H2,1H3,(H,16,17,18) |
| InChIKey | IQNZALSFBWCNSL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone?
The IUPAC name of 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone (CID 71836281) is 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone.
What is the SMILES notation for 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone?
The canonical SMILES for 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone is COCC(=O)N1CCC(Nc2ncnc3c2CCC3)CC1.
What is the InChIKey of 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone?
The InChIKey is IQNZALSFBWCNSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-21-9-14(20)19-7-5-11(6-8-19)18-15-12-3-2-4-13(12)16-10-17-15/h10-11H,2-9H2,1H3,(H,16,17,18).
What are the key properties of 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone?
1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone has a molecular weight of 290.37 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-ylamino)piperidin-1-yl]-2-methoxyethanone is sourced from PubChem (CID 71836281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).