About 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone
2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone (PubChem CID 71836315) has the molecular formula C15H22N4O
and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone.
Molecular Properties
| Compound Name | 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone |
| PubChem CID | 71836315 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1nc2c(c(N(C)CC(=O)N3CCCC3)n1)CCC2 |
| InChI | InChI=1S/C15H22N4O/c1-11-16-13-7-5-6-12(13)15(17-11)18(2)10-14(20)19-8-3-4-9-19/h3-10H2,1-2H3 |
| InChIKey | HXQFANVIYCKCIG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone?
The IUPAC name of 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone (CID 71836315) is 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone.
What is the SMILES notation for 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone?
The canonical SMILES for 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone is Cc1nc2c(c(N(C)CC(=O)N3CCCC3)n1)CCC2.
What is the InChIKey of 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone?
The InChIKey is HXQFANVIYCKCIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O/c1-11-16-13-7-5-6-12(13)15(17-11)18(2)10-14(20)19-8-3-4-9-19/h3-10H2,1-2H3.
What are the key properties of 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone?
2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone has a molecular weight of 274.37 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-(2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]-1-pyrrolidin-1-ylethanone is sourced from PubChem (CID 71836315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).