About N-cycloheptyl-3,5-dinitropyridin-2-amine
N-cycloheptyl-3,5-dinitropyridin-2-amine (PubChem CID 71836620) has the molecular formula C12H16N4O4
and a molecular weight of 280.28 g/mol. Its IUPAC name is N-cycloheptyl-3,5-dinitropyridin-2-amine.
Molecular Properties
| Compound Name | N-cycloheptyl-3,5-dinitropyridin-2-amine |
| PubChem CID | 71836620 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-cycloheptyl-3,5-dinitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NC2CCCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N4O4/c17-15(18)10-7-11(16(19)20)12(13-8-10)14-9-5-3-1-2-4-6-9/h7-9H,1-6H2,(H,13,14) |
| InChIKey | LUALYJQKFYZDSO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cycloheptyl-3,5-dinitropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-3,5-dinitropyridin-2-amine?
The IUPAC name of N-cycloheptyl-3,5-dinitropyridin-2-amine (CID 71836620) is N-cycloheptyl-3,5-dinitropyridin-2-amine.
What is the SMILES notation for N-cycloheptyl-3,5-dinitropyridin-2-amine?
The canonical SMILES for N-cycloheptyl-3,5-dinitropyridin-2-amine is O=[N+]([O-])c1cnc(NC2CCCCCC2)c([N+](=O)[O-])c1.
What is the InChIKey of N-cycloheptyl-3,5-dinitropyridin-2-amine?
The InChIKey is LUALYJQKFYZDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O4/c17-15(18)10-7-11(16(19)20)12(13-8-10)14-9-5-3-1-2-4-6-9/h7-9H,1-6H2,(H,13,14).
What are the key properties of N-cycloheptyl-3,5-dinitropyridin-2-amine?
N-cycloheptyl-3,5-dinitropyridin-2-amine has a molecular weight of 280.28 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-3,5-dinitropyridin-2-amine is sourced from PubChem (CID 71836620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).